magnoloside B
Modify Date: 2025-08-25 08:48:19
magnoloside B structure
|
Common Name | magnoloside B | ||
|---|---|---|---|---|
| CAS Number | 116872-05-0 | Molecular Weight | 786.73 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H46O20 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of magnoloside BMagnoloside B is an α-glucosidase inhibitor (IC50=0.69 mM), which can be obtained from Magnolia officinalis stem bark. Magnoloside B shows moderate inhibitory activity against MGC-803 and HepG2 cells. Magnoloside B has the potential to study cancer and diabetes[1]. |
| Name | magnoloside B |
|---|
| Description | Magnoloside B is an α-glucosidase inhibitor (IC50=0.69 mM), which can be obtained from Magnolia officinalis stem bark. Magnoloside B shows moderate inhibitory activity against MGC-803 and HepG2 cells. Magnoloside B has the potential to study cancer and diabetes[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: α-glucosidase (0.69 mM). |
| References |
| Molecular Formula | C35H46O20 |
|---|---|
| Molecular Weight | 786.73 |
| Exact Mass | 786.25800 |
| PSA | 324.44000 |
| InChIKey | MGCIVWNKCIWQHX-UHFFFAOYSA-N |
| SMILES | CC1OC(OC2C(OCCc3ccc(O)c(O)c3)OC(COC3OC(CO)C(O)C(O)C3O)C(O)C2OC(=O)C=Cc2ccc(O)c(O)c2)C(O)C(O)C1O |
| Hazard Codes | Xi |
|---|