4'-Fluoro[1,1'-biphenyl]-4-sulfonyl chloride
Modify Date: 2025-08-25 17:32:44
![4'-Fluoro[1,1'-biphenyl]-4-sulfonyl chloride Structure](https://image.chemsrc.com/caspic/007/116748-66-4.png)
4'-Fluoro[1,1'-biphenyl]-4-sulfonyl chloride structure
|
Common Name | 4'-Fluoro[1,1'-biphenyl]-4-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 116748-66-4 | Molecular Weight | 270.70700 | |
| Density | 1.384g/cm3 | Boiling Point | 372.9ºC at 760 mmHg | |
| Molecular Formula | C12H8ClFO2S | Melting Point | 82ºC | |
| MSDS | Chinese USA | Flash Point | 179.3ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 4'-Fluorobiphenyl-4-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.384g/cm3 |
|---|---|
| Boiling Point | 372.9ºC at 760 mmHg |
| Melting Point | 82ºC |
| Molecular Formula | C12H8ClFO2S |
| Molecular Weight | 270.70700 |
| Flash Point | 179.3ºC |
| Exact Mass | 269.99200 |
| PSA | 42.52000 |
| LogP | 4.50100 |
| Vapour Pressure | 2E-05mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | CIDMHDJTWVMBIF-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(-c2ccc(F)cc2)cc1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Hazard Codes | C |
| Risk Phrases | 14-34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3261 8 / PGII |
| HS Code | 2904909090 |
|
~%
4'-Fluoro[1,1'-... CAS#:116748-66-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 49, # 25 p. 7487 - 7492 |
|
~%
4'-Fluoro[1,1'-... CAS#:116748-66-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 49, # 25 p. 7487 - 7492 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-(4-fluorophenyl)benzenesulfonyl chloride |
| 4′-Fluorobiphenyl-4-sulfonyl chloride |
| MFCD01631921 |