Pregn-5-en-20-one,3,21-dihydroxy-, (3b)- structure
|
Common Name | Pregn-5-en-20-one,3,21-dihydroxy-, (3b)- | ||
|---|---|---|---|---|
| CAS Number | 1164-98-3 | Molecular Weight | 332.47700 | |
| Density | 1.15g/cm3 | Boiling Point | 483.4ºC at 760mmHg | |
| Molecular Formula | C21H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.2ºC | |
Use of Pregn-5-en-20-one,3,21-dihydroxy-, (3b)-21-Hydroxypregnenolone is an essential intermediate in corticosterone synthesis. |
| Name | 21-hydroxypregnenolone |
|---|---|
| Synonym | More Synonyms |
| Description | 21-Hydroxypregnenolone is an essential intermediate in corticosterone synthesis. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 483.4ºC at 760mmHg |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.47700 |
| Flash Point | 260.2ºC |
| Exact Mass | 332.23500 |
| PSA | 57.53000 |
| LogP | 3.48770 |
| Vapour Pressure | 2.26E-11mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | MOIQRAOBRXUWGN-WPWXJNKXSA-N |
| SMILES | CC12CCC(O)CC1=CCC1C2CCC2(C)C(C(=O)CO)CCC12 |
| 21-hydroxypregnenolone |
| 3beta,21-dihydroxy-5-pregnen-20-one |
| 5-pregnen-3beta,21-diol-20-one |
| 21-hydroxypregnolone |