Levobetaxolol hydrochloride structure
|
Common Name | Levobetaxolol hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 116209-55-3 | Molecular Weight | 343.889 | |
| Density | N/A | Boiling Point | 448ºC at 760 mmHg | |
| Molecular Formula | C18H30ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.7ºC | |
Use of Levobetaxolol hydrochlorideLevobetaxolol hydrochloride is a beta-adrenergic receptor inhibitor (beta blocker), used to lower the pressure in the eye in treating conditions such as glaucoma. |
| Name | (2S)-1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-(propan-2-ylamino)propan-2-ol,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Levobetaxolol hydrochloride is a beta-adrenergic receptor inhibitor (beta blocker), used to lower the pressure in the eye in treating conditions such as glaucoma. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 448ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H30ClNO3 |
| Molecular Weight | 343.889 |
| Flash Point | 224.7ºC |
| Exact Mass | 343.191437 |
| PSA | 50.72000 |
| LogP | 3.58630 |
| Vapour Pressure | 8.26E-09mmHg at 25°C |
| InChIKey | CHDPSNLJFOQTRK-LMOVPXPDSA-N |
| SMILES | CC(C)NCC(O)COc1ccc(CCOCC2CC2)cc1.Cl |
| Storage condition | -20℃ |
| Betaxon |
| AL 1577A |
| (2s)-1-(4-(2-(cyclopropylmethoxy)ethyl)phenoxy)-3-((1-methylethyl)amino)-2-propanol hydrochloride |
| LEVOBETAXOLOL HYDROCHLORIDE |
| 2-Propanol, 1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-[(1-methylethyl)amino]-, (2S)-, hydrochloride (1:1) |
| (2S)-1-{4-[2-(Cyclopropylmethoxy)ethyl]phenoxy}-3-(isopropylamino)-2-propanol hydrochloride (1:1) |
| Levobetaxolol HCl |