3-(4-fluorophenyl)-4-methyl-1H-1,2,4-triazol-5-one structure
|
Common Name | 3-(4-fluorophenyl)-4-methyl-1H-1,2,4-triazol-5-one | ||
|---|---|---|---|---|
| CAS Number | 116114-21-7 | Molecular Weight | 193.17800 | |
| Density | 1.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H8FN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-fluorophenyl)-4-methyl-1H-1,2,4-triazol-5-one |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Molecular Formula | C9H8FN3O |
| Molecular Weight | 193.17800 |
| Exact Mass | 193.06500 |
| PSA | 50.94000 |
| LogP | 1.32680 |
| Index of Refraction | 1.625 |
| InChIKey | VWNZCRPRNPRKND-UHFFFAOYSA-N |
| SMILES | Cn1c(-c2ccc(F)cc2)n[nH]c1=O |
|
~54%
3-(4-fluorophen... CAS#:116114-21-7 |
| Literature: Kane, John M. Synthesis, 1987 , # 10 p. 912 - 914 |
|
~%
3-(4-fluorophen... CAS#:116114-21-7 |
| Literature: Kane; Baron; Dudley; Sorensen; Staeger; Miller Journal of Medicinal Chemistry, 1990 , vol. 33, # 10 p. 2772 - 2777 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |