tert-butyl 4-formylpyridin-3-ylcarbamate structure
|
Common Name | tert-butyl 4-formylpyridin-3-ylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 116026-95-0 | Molecular Weight | 222.240 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 310.0±27.0 °C at 760 mmHg | |
| Molecular Formula | C11H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.3±23.7 °C | |
| Name | tert-butyl N-(4-formylpyridin-3-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 310.0±27.0 °C at 760 mmHg |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.240 |
| Flash Point | 141.3±23.7 °C |
| Exact Mass | 222.100449 |
| PSA | 68.29000 |
| LogP | 2.59 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | YLKONQAWPOHLPX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cnccc1C=O |
| HS Code | 2933399090 |
|---|
|
~60%
tert-butyl 4-fo... CAS#:116026-95-0 |
| Literature: INCYTE CORPORATION Patent: WO2007/38215 A1, 2007 ; Location in patent: Page/Page column 104-105 ; WO 2007/038215 A1 |
|
~64%
tert-butyl 4-fo... CAS#:116026-95-0 |
| Literature: Venuti, Michael C.; Stephenson, Robert A.; Alvarez, Robert; Bruno, John J.; Strosberg, Arthur M. Journal of Medicinal Chemistry, 1988 , vol. 31, # 11 p. 2136 - 2145 |
|
~48%
tert-butyl 4-fo... CAS#:116026-95-0 |
| Literature: BAYER HEALTHCARE AG Patent: WO2005/113552 A1, 2005 ; Location in patent: Page/Page column 21-22 ; |
|
~%
tert-butyl 4-fo... CAS#:116026-95-0 |
| Literature: US6479512 B1, ; US 6479512 B1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| t-Butyl4-formylpyridin-3-ylcarbamate |
| N3-BOC-3-AMINOPYRIDINE-4-CARBOXALDEHYDE |
| tert-butyl 4-formylpyridin-3-ylcarbamate |
| N-Boc-3-amino-4-pyridine carboxaldehyde |
| (4-Formyl-pyridin-3-yl)-carbamic acid tert-butyl ester |
| 2-Methyl-2-propanyl (4-formyl-3-pyridinyl)carbamate |
| Carbamic acid, N-(4-formyl-3-pyridinyl)-, 1,1-dimethylethyl ester |
| N-Boc-3-Amino-4-formylpyridine |
| tert-Butyl (4-formylpyridin-3-yl)carbamate |
| tert-Butyl-(4-formylpyridin-3-yl)carbamat |