Sulfabrom
Modify Date: 2025-09-18 11:13:07
Sulfabrom structure
|
Common Name | Sulfabrom | ||
|---|---|---|---|---|
| CAS Number | 116-45-0 | Molecular Weight | 357.22600 | |
| Density | 1.653g/cm3 | Boiling Point | 568.3ºC at 760 mmHg | |
| Molecular Formula | C12H13BrN4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.5ºC | |
Use of SulfabromSulfabrom (N 3517; Sulfabromomethazine) is a long-acting veterinary medicine that is used for the treatment of coccidiosis and various bacterial infections in the poultry, swine and cattle. |
| Name | 4-amino-N-(5-bromo-4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | Sulfabrom (N 3517; Sulfabromomethazine) is a long-acting veterinary medicine that is used for the treatment of coccidiosis and various bacterial infections in the poultry, swine and cattle. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.653g/cm3 |
|---|---|
| Boiling Point | 568.3ºC at 760 mmHg |
| Molecular Formula | C12H13BrN4O2S |
| Molecular Weight | 357.22600 |
| Flash Point | 297.5ºC |
| Exact Mass | 355.99400 |
| PSA | 106.35000 |
| LogP | 3.97390 |
| Vapour Pressure | 6.23E-13mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | KWXCNODTHBHSIQ-UHFFFAOYSA-N |
| SMILES | Cc1nc(NS(=O)(=O)c2ccc(N)cc2)nc(C)c1Br |
| Storage condition | 2-8℃ |
| WGK Germany | 2 |
|---|---|
| Packaging Group | III |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Bromosulfamethazine |
| S. N. 3517 |
| 2-sulfanilamide-5-bromo-4,6-dimethyl pyrimidine |
| sulfabromomethazine |
| 5-Bromosulfamethazine |
| EINECS 204-142-6 |
| Sulfabrom |
| Sulfabromomethazine sodium |