Sulfaproxiline
Modify Date: 2025-08-25 08:12:41
Sulfaproxiline structure
|
Common Name | Sulfaproxiline | ||
|---|---|---|---|---|
| CAS Number | 116-42-7 | Molecular Weight | 334.39000 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H18N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SulfaproxilineSulfaproxiline is a synthetic antimicrobial drug that is sulfonamide. |
| Name | N-(4-aminophenyl)sulfonyl-4-propan-2-yloxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Description | Sulfaproxiline is a synthetic antimicrobial drug that is sulfonamide. |
|---|---|
| Related Catalog | |
| Target |
antimicrobial |
| Density | 1.29g/cm3 |
|---|---|
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.39000 |
| Exact Mass | 334.09900 |
| PSA | 106.87000 |
| LogP | 4.22760 |
| Index of Refraction | 1.593 |
| InChIKey | FBFBRAFXKGRRHI-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1ccc(C(=O)NS(=O)(=O)c2ccc(N)cc2)cc1 |
| Storage condition | 2-8℃ |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Sulphaproxyline |
| Sulfaproxyline |
| Sulfaproxylin |
| 4-Isopropoxy-benzoesaeure-sulfanilylamid |
| p-Isopropoxy-N-sulfanilylbenzamide |
| EINECS 204-140-5 |
| Sulfaproxiline |