Ruzadolane
Modify Date: 2025-08-25 17:49:06
Ruzadolane structure
|
Common Name | Ruzadolane | ||
|---|---|---|---|---|
| CAS Number | 115762-17-9 | Molecular Weight | 375.43900 | |
| Density | 1.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H19F2N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RuzadolaneRuzadolane is a non-narcotic, centrally-acting analgesic agent. |
| Name | 3-[2-[4-(2,4-difluorophenyl)piperazin-1-yl]ethylsulfanyl]-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| Synonym | More Synonyms |
| Description | Ruzadolane is a non-narcotic, centrally-acting analgesic agent. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.38g/cm3 |
|---|---|
| Molecular Formula | C18H19F2N5S |
| Molecular Weight | 375.43900 |
| Exact Mass | 375.13300 |
| PSA | 61.97000 |
| LogP | 2.92470 |
| Index of Refraction | 1.668 |
| InChIKey | LOKBLLCVOKCEFR-UHFFFAOYSA-N |
| SMILES | Fc1ccc(N2CCN(CCSc3nnc4ccccn34)CC2)c(F)c1 |
| Storage condition | 2-8℃ |
| 3-((2-(4-(2,4-Difluorophenyl)-1-piperazinyl)ethyl)thio)-s-triazolo(4,3-a)pyridine |
| UNII-ZKV3GT35TR |
| Ruzadolane |
| UP 26-91 |