o-(Methacryloxyethyl)-N-(triethoxysilylpropyl)urethane
Modify Date: 2025-08-27 20:18:02
o-(Methacryloxyethyl)-N-(triethoxysilylpropyl)urethane structure
|
Common Name | o-(Methacryloxyethyl)-N-(triethoxysilylpropyl)urethane | ||
|---|---|---|---|---|
| CAS Number | 115396-93-5 | Molecular Weight | 377.505 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 433.9±30.0 °C at 760 mmHg | |
| Molecular Formula | C16H31NO7Si | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 216.2±24.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(3-triethoxysilylpropylcarbamoyloxy)ethyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 433.9±30.0 °C at 760 mmHg |
| Molecular Formula | C16H31NO7Si |
| Molecular Weight | 377.505 |
| Flash Point | 216.2±24.6 °C |
| Exact Mass | 377.186981 |
| PSA | 92.32000 |
| LogP | 3.36 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.453 |
| InChIKey | HBFXZOMNDOKZCW-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCOC(=O)NCCC[Si](OCC)(OCC)OCC |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P280-P304 + P340 + P312-P305 + P351 + P338-P337 + P313 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Propenoic acid, 2-methyl-, 9,9-diethoxy-4-oxo-3,10-dioxa-5-aza-9-siladodec-1-yl ester |
| 4,4-Diethoxy-9-oxo-3,10-dioxa-8-aza-4-siladodecan-12-yl methacrylate |