2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl chloride structure
|
Common Name | 2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl chloride | ||
|---|---|---|---|---|
| CAS Number | 115385-02-9 | Molecular Weight | 418.93800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H19ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H19ClN2OS |
|---|---|
| Molecular Weight | 418.93800 |
| Exact Mass | 418.09100 |
| PSA | 70.23000 |
| LogP | 5.92800 |
| InChIKey | GGIJWBBVZOLQRS-UHFFFAOYSA-N |
| SMILES | O=C(Cl)Cc1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
|
~%
2-[2-(tritylami... CAS#:115385-02-9 |
| Literature: Ternansky; Draheim; Pike; Counter; Eudaly; Kasher Journal of Medicinal Chemistry, 1993 , vol. 36, # 22 p. 3224 - 3229 |
|
~%
2-[2-(tritylami... CAS#:115385-02-9 |
| Literature: Eli Lilly and Company Patent: US4683227 A1, 1987 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Triphenylmethylaminothiazol-4-yl Acetyl Chloride |