3-(2-hydroxyethylamino)-N-[4-[3-(2-hydroxyethylamino)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide structure
|
Common Name | 3-(2-hydroxyethylamino)-N-[4-[3-(2-hydroxyethylamino)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide | ||
|---|---|---|---|---|
| CAS Number | 115290-23-8 | Molecular Weight | 468.50200 | |
| Density | 1.39g/cm3 | Boiling Point | 853.3ºC at 760mmHg | |
| Molecular Formula | C24H28N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 469.8ºC | |
| Name | 3-(2-hydroxyethylamino)-N-[4-[3-(2-hydroxyethylamino)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 853.3ºC at 760mmHg |
| Molecular Formula | C24H28N4O6 |
| Molecular Weight | 468.50200 |
| Flash Point | 469.8ºC |
| Exact Mass | 468.20100 |
| PSA | 163.84000 |
| LogP | 2.36380 |
| Vapour Pressure | 5.46E-31mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | NSPOAMHEQNOQOG-UHFFFAOYSA-N |
| SMILES | O=C(CCNCCO)Nc1ccc(NC(=O)CCNCCO)c2c1C(=O)c1ccccc1C2=O |
|
~79%
3-(2-hydroxyeth... CAS#:115290-23-8 |
| Literature: Martelli; Dzieduszycka; Stefanska; Bontemps-Gracz; Borowski Journal of Medicinal Chemistry, 1988 , vol. 31, # 10 p. 1956 - 1959 |
|
~%
3-(2-hydroxyeth... CAS#:115290-23-8 |
| Literature: Martelli; Dzieduszycka; Stefanska; Bontemps-Gracz; Borowski Journal of Medicinal Chemistry, 1988 , vol. 31, # 10 p. 1956 - 1959 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |