3-amino-N-(4-methoxyphenyl)benzamide structure
|
Common Name | 3-amino-N-(4-methoxyphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 115175-19-4 | Molecular Weight | 242.27300 | |
| Density | 1.245g/cm3 | Boiling Point | 362.8ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.2ºC | |
| Name | 3-amino-N-(4-methoxyphenyl)benzamide |
|---|
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 362.8ºC at 760 mmHg |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.27300 |
| Flash Point | 173.2ºC |
| Exact Mass | 242.10600 |
| PSA | 64.35000 |
| LogP | 3.18390 |
| Vapour Pressure | 1.89E-05mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | LWJRUDWWISWNHG-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)c2cccc(N)c2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~34%
3-amino-N-(4-me... CAS#:115175-19-4 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 18, # 9 p. 3088 - 3115 |
|
~%
3-amino-N-(4-me... CAS#:115175-19-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 29, # 3 p. 417 - 423 |
|
~%
3-amino-N-(4-me... CAS#:115175-19-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 29, # 3 p. 417 - 423 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |