tert-butyl (3S)-3-acetamidopyrrolidine-1-carboxylate structure
|
Common Name | tert-butyl (3S)-3-acetamidopyrrolidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 114636-37-2 | Molecular Weight | 228.28800 | |
| Density | 1.1g/cm3 | Boiling Point | 381.3ºC at 760 mmHg | |
| Molecular Formula | C11H20N2O3 | Melting Point | 86-90ºC | |
| MSDS | Chinese USA | Flash Point | 184.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tert-butyl (3S)-3-acetamidopyrrolidine-1-carboxylate |
|---|
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 381.3ºC at 760 mmHg |
| Melting Point | 86-90ºC |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.28800 |
| Flash Point | 184.4ºC |
| Exact Mass | 228.14700 |
| PSA | 58.64000 |
| LogP | 1.46070 |
| Vapour Pressure | 5.11E-06mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | SLFZPSKIMUPQSR-VIFPVBQESA-N |
| SMILES | CC(=O)NC1CCN(C(=O)OC(C)(C)C)C1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |