AEEA-AEEA
Modify Date: 2025-08-25 05:21:10
AEEA-AEEA structure
|
Common Name | AEEA-AEEA | ||
|---|---|---|---|---|
| CAS Number | 1143516-05-5 | Molecular Weight | 308.32800 | |
| Density | 1.202±0.06 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H24N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AEEA-AEEAAEEA-AEEA is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). AEEA-AEEA is also a alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1][2]. |
| Name | 17-amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecan-1-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | AEEA-AEEA is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). AEEA-AEEA is also a alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[2]. |
| References |
| Density | 1.202±0.06 g/cm3 |
|---|---|
| Molecular Formula | C12H24N2O7 |
| Molecular Weight | 308.32800 |
| Exact Mass | 308.15800 |
| PSA | 129.34000 |
| InChIKey | YQZVQKYXWPIKIX-UHFFFAOYSA-N |
| SMILES | NCCOCCOCC(=O)NCCOCCOCC(=O)O |
| Water Solubility | Freely soluble (999 g/L) (25 ºC) |
| 17-Amino-10-oxo-3,6,12,15-tetraoxa-9-azaheptadecanoic acid |
| AEEA-AEEA |