Methyl 6-chloro-5-pivalamidopicolinate structure
|
Common Name | Methyl 6-chloro-5-pivalamidopicolinate | ||
|---|---|---|---|---|
| CAS Number | 1142191-95-4 | Molecular Weight | 270.71200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15ClN2O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Methyl 6-chloro-5-pivalamidopicolinate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15ClN2O3 |
|---|---|
| Molecular Weight | 270.71200 |
| Exact Mass | 270.07700 |
| PSA | 68.29000 |
| LogP | 2.57920 |
| InChIKey | MRLNFXVKFSJUHZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(NC(=O)C(C)(C)C)c(Cl)n1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P301 + P312 + P330 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 6-chloro-5-(2,2-dimethylpropanoylamino)pyridine-2-carboxylate |