4-Amino-2,6-dinitrobenzoic acid
Modify Date: 2025-08-27 13:54:39
4-Amino-2,6-dinitrobenzoic acid structure
|
Common Name | 4-Amino-2,6-dinitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 114168-48-8 | Molecular Weight | 227.13100 | |
| Density | 1.775g/cm3 | Boiling Point | 503.2ºC at 760mmHg | |
| Molecular Formula | C7H5N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.1ºC | |
| Name | 4-Amino-2,6-dinitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.775g/cm3 |
|---|---|
| Boiling Point | 503.2ºC at 760mmHg |
| Molecular Formula | C7H5N3O6 |
| Molecular Weight | 227.13100 |
| Flash Point | 258.1ºC |
| Exact Mass | 227.01800 |
| PSA | 154.96000 |
| LogP | 2.41100 |
| Vapour Pressure | 6.04E-11mmHg at 25°C |
| Index of Refraction | 1.719 |
| InChIKey | HRBPUPBLMZFYBP-UHFFFAOYSA-N |
| SMILES | Nc1cc([N+](=O)[O-])c(C(=O)O)c([N+](=O)[O-])c1 |
|
~%
4-Amino-2,6-din... CAS#:114168-48-8 |
| Literature: Schmidt, Torsten C.; Steinbach, Klaus; Buetehorn, Ulf; Heck, Kerstin; Volkwein, Ute; Stork, Gottfried Chemosphere, 1999 , vol. 38, # 13 p. 3119 - 3130 |
|
~%
4-Amino-2,6-din... CAS#:114168-48-8 |
| Literature: Parkes; Farthing Journal of the Chemical Society, 1948 , p. 1275,1277 |
|
~%
4-Amino-2,6-din... CAS#:114168-48-8 |
| Literature: Parkes; Farthing Journal of the Chemical Society, 1948 , p. 1275,1277 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-amino-2,6-dinitro-benzoic acid |
| 4-Amino-2,6-dinitro-benzoesaeure |
| Benzoic acid,4-amino-2,6-dinitro |