4-Hydroxy-3-(3-methylbut-2-en-1-yl)benzoic acid structure
|
Common Name | 4-Hydroxy-3-(3-methylbut-2-en-1-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1138-41-6 | Molecular Weight | 206.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydroxy-3-(3-methylbut-2-enyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14O3 |
|---|---|
| Molecular Weight | 206.23800 |
| Exact Mass | 206.09400 |
| PSA | 57.53000 |
| LogP | 2.59910 |
| InChIKey | LBSJJNAMGVDGCU-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1cc(C(=O)O)ccc1O |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2918290000 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 4-Hydroxy-3-prenylbenzoic Acid |