cis Ned-19
Modify Date: 2025-08-26 20:03:07
cis Ned-19 structure
|
Common Name | cis Ned-19 | ||
|---|---|---|---|---|
| CAS Number | 1137264-00-6 | Molecular Weight | 514.59100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H31FN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of cis Ned-19cis-Ned19 is a chemical probe. cis-Ned19 blocks NAADP signaling and fluorescently labeled NAADP receptors in cell[1]. |
| Name | (1S,3S)-1-(3-{[4-(2-Fluorophenyl)-1-piperazinyl]methyl}-4-methoxy phenyl)-2,3,4,9-tetrahydro-1H-β-carboline-3-carboxylic acid |
|---|
| Description | cis-Ned19 is a chemical probe. cis-Ned19 blocks NAADP signaling and fluorescently labeled NAADP receptors in cell[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C30H31FN4O3 |
|---|---|
| Molecular Weight | 514.59100 |
| Exact Mass | 514.23800 |
| PSA | 80.83000 |
| LogP | 4.65780 |
| InChIKey | FUHCEERDBRGPQZ-LSYYVWMOSA-N |
| SMILES | COc1ccc(C2NC(C(=O)O)Cc3c2[nH]c2ccccc32)cc1CN1CCN(c2ccccc2F)CC1 |