(4-aminophenyl)sulfonylurea,morpholine
Modify Date: 2024-01-13 10:29:21
(4-aminophenyl)sulfonylurea,morpholine structure
|
Common Name | (4-aminophenyl)sulfonylurea,morpholine | ||
|---|---|---|---|---|
| CAS Number | 113712-90-6 | Molecular Weight | 302.35000 | |
| Density | N/A | Boiling Point | 548.4ºC at 760 mmHg | |
| Molecular Formula | C11H18N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.5ºC | |
| Name | (4-aminophenyl)sulfonylurea,morpholine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 548.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H18N4O4S |
| Molecular Weight | 302.35000 |
| Flash Point | 285.5ºC |
| Exact Mass | 302.10500 |
| PSA | 145.91000 |
| LogP | 2.12750 |
| Vapour Pressure | 4.44E-12mmHg at 25°C |
| InChIKey | JDDUXAQQHAZVPM-UHFFFAOYSA-N |
| SMILES | C1COCCN1.NC(=O)NS(=O)(=O)c1ccc(N)cc1 |
| Benzenesulfonamide,4-amino-N-(aminocarbonyl)-,compd. with morpholine (1:1) |
| 4-Amino-N-(aminocarbonyl)benzenesulfonamide compd. with morpholine (1:1) |