(4-aminophenyl)sulfonylurea,2-(2-hydroxyethylamino)ethanol structure
|
Common Name | (4-aminophenyl)sulfonylurea,2-(2-hydroxyethylamino)ethanol | ||
|---|---|---|---|---|
| CAS Number | 113712-92-8 | Molecular Weight | 320.36500 | |
| Density | N/A | Boiling Point | 629.5ºC at 760 mmHg | |
| Molecular Formula | C11H20N4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.5ºC | |
| Name | (4-aminophenyl)sulfonylurea,2-(2-hydroxyethylamino)ethanol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 629.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H20N4O5S |
| Molecular Weight | 320.36500 |
| Flash Point | 334.5ºC |
| Exact Mass | 320.11500 |
| PSA | 177.14000 |
| LogP | 1.14400 |
| Vapour Pressure | 1.03E-16mmHg at 25°C |
| InChIKey | REPXKCVLNYIMKH-UHFFFAOYSA-N |
| SMILES | NC(=O)NS(=O)(=O)c1ccc(N)cc1.OCCNCCO |
| Benzenesulfonamide,4-amino-N-(aminocarbonyl)-,compd. with 2,2'-iminobis(ethanol) (1:1) |
| 4-Amino-N-(aminocarbonyl)benzenesulfonamide compd. with 2,2'-iminobis(ethanol) (1:1) |