(-)-Verrucofortine
Modify Date: 2025-08-25 12:30:00
(-)-Verrucofortine structure
|
Common Name | (-)-Verrucofortine | ||
|---|---|---|---|---|
| CAS Number | 113706-21-1 | Molecular Weight | 409.52100 | |
| Density | 1.21g/cm3 | Boiling Point | 654.4ºC at 760mmHg | |
| Molecular Formula | C24H31N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 349.6ºC | |
Use of (-)-VerrucofortineVerrucofortine, a fungal metabolite, is an alkaloid derived from tryptophan and leucine[1]. |
| Name | Verrucofortine |
|---|---|
| Synonym | More Synonyms |
| Description | Verrucofortine, a fungal metabolite, is an alkaloid derived from tryptophan and leucine[1]. |
|---|---|
| Related Catalog | |
| In Vivo | Studies of verrucofortine toxicity in mice showed no apparent toxic effects at doses as high at 160 mg/kg ip[1]. |
| References |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 654.4ºC at 760mmHg |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.52100 |
| Flash Point | 349.6ºC |
| Exact Mass | 409.23700 |
| PSA | 73.21000 |
| LogP | 3.25340 |
| Vapour Pressure | 5.26E-17mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | BMRZKNPRSPWNNW-UNBWHIKDSA-N |
| SMILES | C=CC(C)(C)C12CC3C(=O)NC(CC(C)C)C(=O)N3C1N(C(C)=O)c1ccccc12 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:61-90-5
CAS#:73-22-3| Fructigenine B |
| (3S,5aR,10bR,11aS)-6-acetyl-10b-(2-methylbut-3-en-2-yl)-3-(2-methylpropyl)-6,10b,11,11a-tetrahydro-2H-pyrazino[1',2':1,5]pyrrolo[2,3-b]indole-1,4(3H,5aH)-dione |
| 6-Acetyl-10b-(1,1-dimethyl-2-propenyl)-3-isobutyl-6,10b,11,11a-tetrahydro-2H-pyrazino[2',1':5,1]pyrrolo[2,3-b]indole-1,4(3H,5aH)-dione |