IDE 2
Modify Date: 2025-09-17 21:12:16
IDE 2 structure
|
Common Name | IDE 2 | ||
|---|---|---|---|---|
| CAS Number | 1136466-93-7 | Molecular Weight | 240.299 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of IDE 2IDE2 is a small molecule cell-permeable inducer of definitive endoderm formation in mouse and human embryonic stem cells (ESCs) by activating the TGF-βsignaling pathway[1]. |
| Name | 7-(2-Cyclopentylidenehydrazino)-7-oxoheptanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | IDE2 is a small molecule cell-permeable inducer of definitive endoderm formation in mouse and human embryonic stem cells (ESCs) by activating the TGF-βsignaling pathway[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.299 |
| Exact Mass | 240.147400 |
| PSA | 82.25000 |
| LogP | 0.33 |
| Index of Refraction | 1.557 |
| InChIKey | CVYPYYPTFNVREL-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCC(=O)NN=C1CCCC1 |
| 7-(2-Cyclopentylidenehydrazino)-7-oxoheptanoic acid |
| Heptanedioic acid, mono(2-cyclopentylidenehydrazide) |
| IDE-2 |