Quizartinib hydrochloride
Modify Date: 2025-12-20 16:39:27
Quizartinib hydrochloride structure
|
Common Name | Quizartinib hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1132827-21-4 | Molecular Weight | 633.58900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H34Cl2N6O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Quizartinib hydrochlorideQuizartinib (AC220) is a potent, selective, second-generation FLT3 inhibitor with Kd of 1.6 nM, inhibits Wt FLT3 and FLT3-ITD autophosphorylation in MV4-11cell with IC50 of 4.2 and 1.1 nM, respectively. |
| Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-[6-(2-morpholin-4-ylethoxy)imidazo[2,1-b][1,3]benzothiazol-2-yl]phenyl]urea,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C29H34Cl2N6O4S |
|---|---|
| Molecular Weight | 633.58900 |
| Exact Mass | 632.17400 |
| PSA | 137.63000 |
| LogP | 6.89330 |
| InChIKey | DHYPGRVMIOATAE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(-c3cn4c(n3)sc3cc(OCCN5CCOCC5)ccc34)cc2)no1.Cl.Cl |
| UNII-WK7Q6ZIZ10 |
| Quizartinib dihydrochloride |