ditert-butyl 2-phenylpropanedioate
Modify Date: 2025-08-21 15:40:08
ditert-butyl 2-phenylpropanedioate structure
|
Common Name | ditert-butyl 2-phenylpropanedioate | ||
|---|---|---|---|---|
| CAS Number | 113279-72-4 | Molecular Weight | 292.37000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ditert-butyl 2-phenylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H24O4 |
|---|---|
| Molecular Weight | 292.37000 |
| Exact Mass | 292.16700 |
| PSA | 52.60000 |
| LogP | 3.45360 |
| InChIKey | SQALYTKPBXUAHL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C(=O)OC(C)(C)C)c1ccccc1 |
|
~85%
ditert-butyl 2-... CAS#:113279-72-4 |
| Literature: HOKKO CHEMICAL INDUSTRY CO. LTD. Patent: EP1688424 A1, 2006 ; Location in patent: Page/Page column 86-87 ; |
|
~88%
ditert-butyl 2-... CAS#:113279-72-4 |
| Literature: Beare, Neil A.; Hartwig, John F. Journal of Organic Chemistry, 2002 , vol. 67, # 2 p. 541 - 555 |
|
~91%
ditert-butyl 2-... CAS#:113279-72-4 |
| Literature: Beare, Neil A.; Hartwig, John F. Journal of Organic Chemistry, 2002 , vol. 67, # 2 p. 541 - 555 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Di-tert.-butyl-phenylmalonat |
| di-tert-butyl 2-phenylmalonate |
| di-tert-butylphenyl malonate |
| Propanedioic acid,phenyl-,bis(1,1-dimethylethyl) ester |
| phenyl di-tert-butylmalonate |