Valilactone structure
|
Common Name | Valilactone | ||
|---|---|---|---|---|
| CAS Number | 113276-96-3 | Molecular Weight | 397.54900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H39NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ValilactoneValilactone is a potent and effective inhibitor of esterase, produced by actinomycetes[1]. |
| Name | (-)-valilactone |
|---|---|
| Synonym | More Synonyms |
| Description | Valilactone is a potent and effective inhibitor of esterase, produced by actinomycetes[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H39NO5 |
|---|---|
| Molecular Weight | 397.54900 |
| Exact Mass | 397.28300 |
| PSA | 81.70000 |
| LogP | 5.17800 |
| InChIKey | WWGVIIVMPMBQFV-MUGJNUQGSA-N |
| SMILES | CCCCCCC1C(=O)OC1CC(CCCCC)OC(=O)C(NC=O)C(C)C |
| Hazard Codes | Xi |
|---|
| valilactone |
| (2S,2'S,3'S)-1-(3-hexyl-4-oxooxetan-2-yl)heptan-2-yl (S)-N-formyl-3-methylbutanoate |
| (S)-2-Formylamino-3-methyl-butyric acid (S)-1-((2S,3S)-3-hexyl-4-oxo-oxetan-2-ylmethyl)-hexyl ester |
| N-formyl-L-valine-(S)-1-[[(2S,3S)-3-hexyl-4-oxo-2-oxetanyl]methyl]hexyl ester |
| (2S,2'S,3'S)-1-(3'-hexyl-4'-oxooxetan-2'-yl)heptan-2-yl (S)-N-formyl-valinate |
| (S)-((S)-1-((2S,3S)-3-hexyl-4-oxooxetan-2-yl)heptan-2-yl) 2-methanamido-3-methylbutanoate |
| N-formyl-L-valine-(S)-1 -[[(2S,3S)-3-hexyl-4-oxo-2-oxetanyl]methyl]hexyl ester |