3,5-di-tert-butyl-1H-pyrazole
Modify Date: 2025-09-17 21:58:11
3,5-di-tert-butyl-1H-pyrazole structure
|
Common Name | 3,5-di-tert-butyl-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 1132-14-5 | Molecular Weight | 180.29000 | |
| Density | 0.927g/cm3 | Boiling Point | 255.3ºC at 760mmHg | |
| Molecular Formula | C11H20N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.5ºC | |
| Name | 3,5-ditert-butyl-1H-pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 0.927g/cm3 |
|---|---|
| Boiling Point | 255.3ºC at 760mmHg |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29000 |
| Flash Point | 95.5ºC |
| Exact Mass | 180.16300 |
| PSA | 28.68000 |
| LogP | 3.00470 |
| Vapour Pressure | 0.0264mmHg at 25°C |
| Index of Refraction | 1.483 |
| InChIKey | UEQDCVLVDQENIN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)[nH]n1 |
| HS Code | 2933199090 |
|---|
|
~94%
3,5-di-tert-but... CAS#:1132-14-5 |
| Literature: Fernandez-Castano, Cristina; Foces-Foces, Concepcion; Jagerovic, Nadine; Elguero, Jose Journal of Molecular Structure, 1995 , vol. 355, p. 265 - 272 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,5-Di-t-butylpyrazole |
| 1H-Pyrazole,3,5-bis(1,1-dimethylethyl) |
| 3,5-bis(tert-butyl)pyrazol |
| 3,5-tBu2-pyrazole |
| (3,5-di-tert-butyl)pyrazole |
| 3,5-di-tert-butyl-1H-pyrazole |