4-[3,5-DI(TERT-BUTYL)-1H-PYRAZOL-1-YL]ANILINE structure
|
Common Name | 4-[3,5-DI(TERT-BUTYL)-1H-PYRAZOL-1-YL]ANILINE | ||
|---|---|---|---|---|
| CAS Number | 52708-33-5 | Molecular Weight | 271.40100 | |
| Density | 1.01g/cm3 | Boiling Point | 375.8ºC at 760 mmHg | |
| Molecular Formula | C17H25N3 | Melting Point | 205ºC | |
| MSDS | N/A | Flash Point | 181.1ºC | |
| Name | 4-(3,5-ditert-butylpyrazol-1-yl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 375.8ºC at 760 mmHg |
| Melting Point | 205ºC |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.40100 |
| Flash Point | 181.1ºC |
| Exact Mass | 271.20500 |
| PSA | 43.84000 |
| LogP | 4.63070 |
| Index of Refraction | 1.546 |
| InChIKey | FMNZOGJPLKROCT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)n(-c2ccc(N)cc2)n1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-[3,5-di(tert-butyl)-1H-pyrazol-1-yl]aniline |
| HMS564E16 |