5H,5H-Perfluorononane-4,6-dione
Modify Date: 2025-08-20 11:38:15
5H,5H-Perfluorononane-4,6-dione structure
|
Common Name | 5H,5H-Perfluorononane-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 113116-18-0 | Molecular Weight | 408.08900 | |
| Density | 1.64 g/mL at 25ºC(lit.) | Boiling Point | 97ºC(lit.) | |
| Molecular Formula | C9H2F14O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 136 °F | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
| Name | 1,1,1,2,2,3,3,7,7,8,8,9,9,9-tetradecafluorononane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 97ºC(lit.) |
| Molecular Formula | C9H2F14O2 |
| Molecular Weight | 408.08900 |
| Flash Point | 136 °F |
| Exact Mass | 407.98300 |
| PSA | 34.14000 |
| LogP | 4.18050 |
| Vapour Pressure | 1.64mmHg at 25°C |
| Index of Refraction | n20/D 1.323(lit.) |
| InChIKey | NICYPDXBQUERJQ-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
J. Coord. Chem. 38 , 319, (1996)
|
|
|
Adv. Mater. Optic Electron 1 , 81, (1992)
|
|
|
Synthesis, characterization and crystal structure of a new thermally stable and volatile precursor [bis (1, 1, 1, 2, 2, 3, 3, 7, 7, 8, 8, 9, 9, 9-tetradecafluorononane-4, 6-dionato) 2-tetraglyme] barium (II) for MOCVD application. Malandrino G, et al.
J. Mater. Chem. 4(7) , 1061-66, (1994)
|
| 5H,5H-Perdecafluoro-4,6-nonandione |
| 1,1,1,2,2,3,3,7,7,8,8,9,9,9-tetradecafluoro-4,6-nonadione |
| MFCD00239444 |
| 5H,5H-Perfluorononane-4,6-dione |
| 1,1,1,2,2,3,3,7,7,8,8,9,9,9-Tetradecafluoro-4,6-nonanedione |