tert-Butyl 4-(prop-2-yn-1-ylamino)benzoate structure
|
Common Name | tert-Butyl 4-(prop-2-yn-1-ylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 112888-76-3 | Molecular Weight | 231.290 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 357.7±27.0 °C at 760 mmHg | |
| Molecular Formula | C14H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.1±23.7 °C | |
| Name | tert-butyl 4-(prop-2-ynylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 357.7±27.0 °C at 760 mmHg |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.290 |
| Flash Point | 170.1±23.7 °C |
| Exact Mass | 231.125931 |
| PSA | 38.33000 |
| LogP | 3.53 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | WCHCOTTZGIWYPX-UHFFFAOYSA-N |
| SMILES | C#CCNc1ccc(C(=O)OC(C)(C)C)cc1 |
| HS Code | 2922499990 |
|---|
|
~85%
tert-Butyl 4-(p... CAS#:112888-76-3 |
| Literature: ONYX PHARMACEUTICALS, INC.; KERSCHEN, James, Alan; BRIDGES, Alexander, James; DALZIEL, Sean, Mark; DAPREMONT, Olivier; KIM, Hyunjung; THOMPSON, Andrew, S.; ZELLER, James, Robert Patent: WO2012/11939 A2, 2012 ; Location in patent: Page/Page column 61-62 ; |
|
~47%
tert-Butyl 4-(p... CAS#:112888-76-3 |
| Literature: Bisset, Graham M. F.; Pawelczak, Krzysztof; Jackman, Ann L.; Calvert, A. Hilary; Hughes, Leslie R. Journal of Medicinal Chemistry, 1992 , vol. 35, # 5 p. 859 - 866 |
|
~%
tert-Butyl 4-(p... CAS#:112888-76-3 |
| Literature: WO2012/11939 A2, ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| tert-butyl-4-(prop-2-ynylamino)benzoate |
| FD7135 |
| TERT-BUTYL 4-(2-PROPYNYLAMINO)BENZOATE |
| Benzoic acid, 4-(2-propyn-1-ylamino)-, 1,1-dimethylethyl ester |
| tert-butyl 4-N-(prop-2-ynyl)aminobenzoate |
| 2-Methyl-2-propanyl 4-(2-propyn-1-ylamino)benzoate |
| tert-butyl p-[N-(prop-2-ynyl)amino]benzoate |
| tert-Butyl 4-(prop-2-yn-1-ylamino)benzoate |
| tert-butyl p-(prop-2-ynyl)aminobenzoate |