soluflazine
Modify Date: 2025-08-26 19:50:30
soluflazine structure
|
Common Name | soluflazine | ||
|---|---|---|---|---|
| CAS Number | 112415-83-5 | Molecular Weight | 631.39600 | |
| Density | N/A | Boiling Point | 788.2ºC at 760mmHg | |
| Molecular Formula | C28H32Cl4FN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 430.5ºC | |
Use of soluflazineSoluflazine is a nucleoside transport inhibitor with anticonvulsant action. Soluflazine can be used as an antiepileptic agent[1]. |
| Name | 4-[2-(2,6-dichloroanilino)-2-oxoethyl]-1-[4-(4-fluorophenyl)-4-pyridin-3-ylbutyl]piperazine-2-carboxamide,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Soluflazine is a nucleoside transport inhibitor with anticonvulsant action. Soluflazine can be used as an antiepileptic agent[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 788.2ºC at 760mmHg |
|---|---|
| Molecular Formula | C28H32Cl4FN5O2 |
| Molecular Weight | 631.39600 |
| Flash Point | 430.5ºC |
| Exact Mass | 629.12900 |
| PSA | 96.04000 |
| LogP | 7.82880 |
| Vapour Pressure | 8.19E-25mmHg at 25°C |
| InChIKey | KQZLAOQGNIIITJ-UHFFFAOYSA-N |
| SMILES | Cl.Cl.NC(=O)C1CN(CC(=O)Nc2c(Cl)cccc2Cl)CCN1CCCC(c1ccc(F)cc1)c1cccnc1 |
| 1-Piperazineacetamide,3-(aminocarbonyl)-N-(2,6-dichlorophenyl)-4-[4-(4-fluorophenyl)-4-(3-pyridinyl)butyl]-,hydrochloride (1:2) |
| Soluflazine |
| 4-{2-[(2,6-dichlorophenyl)amino]-2-oxoethyl}-1-[4-(4-fluorophenyl)-4-(pyridin-3-yl)butyl]piperazine-2-carboxamide dihydrochloride |
| Soluflazine Dihydrochloride |