SMPT structure
|
Common Name | SMPT | ||
|---|---|---|---|---|
| CAS Number | 112241-19-7 | Molecular Weight | 388.46100 | |
| Density | 1.43g/cm3 | Boiling Point | 547ºC at 760mmHg | |
| Molecular Formula | C18H16N2O4S2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 284.6ºC | |
Use of SMPTSMPT is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | (2,5-dioxopyrrolidin-1-yl) 4-[1-(pyridin-2-yldisulfanyl)ethyl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Description | SMPT is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Non-cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 547ºC at 760mmHg |
| Molecular Formula | C18H16N2O4S2 |
| Molecular Weight | 388.46100 |
| Flash Point | 284.6ºC |
| Exact Mass | 388.05500 |
| PSA | 127.17000 |
| LogP | 3.74180 |
| Vapour Pressure | 5.11E-12mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | GKSPIZSKQWTXQG-UHFFFAOYSA-N |
| SMILES | CC(SSc1ccccn1)c1ccc(C(=O)ON2C(=O)CCC2=O)cc1 |
| 1-({4-[1-(pyridin-2-yldisulfanyl)ethyl]benzoyl}oxy)pyrrolidine-2,5-dione |
| SMPT |
| 2,5-Pyrrolidinedione,1-((4-(1-(2-pyridinyldithio)ethyl)benzoyl)oxy) |