Tebufelone
Modify Date: 2025-08-25 14:46:25
Tebufelone structure
|
Common Name | Tebufelone | ||
|---|---|---|---|---|
| CAS Number | 112018-00-5 | Molecular Weight | 300.43500 | |
| Density | 0.992g/cm3 | Boiling Point | 383.6ºC at 760mmHg | |
| Molecular Formula | C20H28O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.8ºC | |
Use of TebufeloneTebufelone (NE-11740), a nonsteroidal anti-inflammatory drug (NSAID), is a selective dual COX-2/5-lipoxygenase inhibitor. Tebufelone displays potent anti-inflammatory, analgesic and anti-pyretic properties[1][2]. |
| Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)hex-5-yn-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | Tebufelone (NE-11740), a nonsteroidal anti-inflammatory drug (NSAID), is a selective dual COX-2/5-lipoxygenase inhibitor. Tebufelone displays potent anti-inflammatory, analgesic and anti-pyretic properties[1][2]. |
|---|---|
| Related Catalog | |
| Target |
COX-2 5-LO |
| References |
| Density | 0.992g/cm3 |
|---|---|
| Boiling Point | 383.6ºC at 760mmHg |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.43500 |
| Flash Point | 163.8ºC |
| Exact Mass | 300.20900 |
| PSA | 37.30000 |
| LogP | 4.97340 |
| Vapour Pressure | 1.97E-06mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | ZHXUEUKVDMWSKV-UHFFFAOYSA-N |
| SMILES | C#CCCCC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| 4-(5'-hexynoyl)-2,6-di-tert-butylphenol |
| Tebufelone |
| Tebufelonum [INN-Latin] |
| 5-Hexyn-1-one,1-(3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl) |
| Tebufelona |
| Tebufelone [USAN:INN] |
| Tebufelonum |
| Tebufelona [INN-Spanish] |
| 4-(5'-hexynoyl)-2,6-di-t-butylphenol |