ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate
Modify Date: 2025-08-25 13:21:23
ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate structure
|
Common Name | ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 111787-82-7 | Molecular Weight | 282.72000 | |
| Density | 1.213g/cm3 | Boiling Point | 420.9ºC at 760mmHg | |
| Molecular Formula | C14H15ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.7ºC | |
| Name | ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 420.9ºC at 760mmHg |
| Molecular Formula | C14H15ClO4 |
| Molecular Weight | 282.72000 |
| Flash Point | 167.7ºC |
| Exact Mass | 282.06600 |
| PSA | 60.44000 |
| LogP | 2.68110 |
| Vapour Pressure | 2.71E-07mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | FQMARORYZJGMIZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC(=O)c1ccc(Cl)cc1)C(C)=O |
| HS Code | 2918300090 |
|---|
|
~81%
ethyl 2-acetyl-... CAS#:111787-82-7 |
| Literature: Casagrande, Manolo; Basilico, Nicoletta; Rusconi, Chiara; Taramelli, Donatella; Sparatore, Anna Bioorganic and Medicinal Chemistry, 2010 , vol. 18, # 18 p. 6625 - 6633 |
CAS#:111808-94-7
CAS#:111787-84-9
CAS#:111787-89-4| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| estere etilico dell'acido 2-(4-clorofenacil)-3-ossibutanoico |
| 2-(2-(4-chloro-phenyl)-2-oxo-ethyl)-3-oxo-butyric acid ethyl ester |
| HMS565I05 |
| Benzenebutanoic acid,a-acetyl-4-chloro-g-oxo-,ethyl ester |
| ethyl 2-acetyl-4-(4-chlorophenyl)-oxobutanoate |
| ethyl 2-(4-chlorophenacyl)3-oxobutanoate |