2-METHYL-5-PYRIDINETRIFLUOROMETHANESULF& structure
|
Common Name | 2-METHYL-5-PYRIDINETRIFLUOROMETHANESULF& | ||
|---|---|---|---|---|
| CAS Number | 111770-91-3 | Molecular Weight | 241.18800 | |
| Density | 1.412 g/mL at 25ºC(lit.) | Boiling Point | 80-82ºC1.9 mm Hg(lit.) | |
| Molecular Formula | C7H6F3NO3S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 197.6 °F | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | (6-methylpyridin-3-yl) trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.412 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 80-82ºC1.9 mm Hg(lit.) |
| Molecular Formula | C7H6F3NO3S |
| Molecular Weight | 241.18800 |
| Exact Mass | 241.00200 |
| PSA | 64.64000 |
| LogP | 2.69920 |
| Vapour Pressure | 0.013mmHg at 25°C |
| Index of Refraction | n20/D 1.442(lit.) |
| InChIKey | NSSSVJYQTZRVMH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OS(=O)(=O)C(F)(F)F)cn1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Phrases | R25 |
| Safety Phrases | S26 |
| RIDADR | UN 2811 6.1/PG 3 |
| HS Code | 2933399090 |
| Flash Point(F) | 197.6 °F |
| Flash Point(C) | 92 °C |
|
~97%
2-METHYL-5-PYRI... CAS#:111770-91-3 |
| Literature: WYETH; CURIS, INC. Patent: WO2008/57469 A1, 2008 ; Location in patent: Page/Page column 238-239 ; |
|
~95%
2-METHYL-5-PYRI... CAS#:111770-91-3 |
| Literature: SHIONOGI and CO., LTD. Patent: EP1422218 A1, 2004 ; Location in patent: Page 157; 158; 225 ; |
|
~88%
2-METHYL-5-PYRI... CAS#:111770-91-3 |
| Literature: Tilley, Jefferson W.; Zawoiski, Sonja Journal of Organic Chemistry, 1988 , vol. 53, # 2 p. 386 - 390 |
|
~34%
2-METHYL-5-PYRI... CAS#:111770-91-3 |
| Literature: Dinnell, Kevin; Elliott, Jason Matthew; Hollingworth, Gregory John; Ridgill, Mark Peter; Shaw, Duncan Edward Patent: US2001/39286 A1, 2001 ; |
|
~%
2-METHYL-5-PYRI... CAS#:111770-91-3 |
| Literature: US5922742 A1, ; |
|
~%
2-METHYL-5-PYRI... CAS#:111770-91-3 |
| Literature: US5202321 A1, ; |
| Precursor 6 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-5-pyridinetrifluoromethanesulfonate |
| trifluoromethanesulfonic acid 2-methyl-5-pyridinyl ester |
| 6-methylpyridin-3-yl trifluoromethanesulfonate |
| MFCD06798124 |
| trifluoromethanesulfonic acid 2-methylpyridin-5-yl ester |
| trifluoromethanesulfonic acid 6-methylpyridin-3-yl ester |
| Methanesulfonic acid,trifluoro-,6-methyl-3-pyridinyl ester |
| 2-methyl-5-(trifluoromethylsulfonyloxy)pyridine |
| trifluoromethanesulfonic acid 6-methyl-3-pyridinyl ester |
| (2-methylpyridine-5-yl)trifluoromethanesulfonate |
| 2-Methyl-5-pyridyl triflate |