3-ethyl-6-iodo-2-sulfanylidene-1H-quinazolin-4-one
Modify Date: 2025-08-28 18:13:22
3-ethyl-6-iodo-2-sulfanylidene-1H-quinazolin-4-one structure
|
Common Name | 3-ethyl-6-iodo-2-sulfanylidene-1H-quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 111631-31-3 | Molecular Weight | 332.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9IN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-ethyl-6-iodo-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9IN2OS |
|---|---|
| Molecular Weight | 332.16100 |
| Exact Mass | 331.94800 |
| PSA | 73.69000 |
| LogP | 2.30970 |
| InChIKey | SJQXHVYZTGTKQG-UHFFFAOYSA-N |
| SMILES | CCn1c(=S)[nH]c2ccc(I)cc2c1=O |
|
~49%
3-ethyl-6-iodo-... CAS#:111631-31-3 |
| Literature: Lakhan; Singh Journal of the Indian Chemical Society, 1987 , vol. 64, # 5 p. 316 - 318 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4(1H)-Quinazolinone,3-ethyl-2,3-dihydro-6-iodo-2-thioxo |
| 2-thio-3-ethyl-6-iodo-4(3H)-quinazolinone |
| 6-Iodo-3-ethyl-2-thioxo-4(3H)quinazolinone |