ethyl1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylate structure
|
Common Name | ethyl1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 111493-74-4 | Molecular Weight | 222.16400 | |
| Density | 1.35g/cm3 | Boiling Point | 267.4ºC at 760mmHg | |
| Molecular Formula | C8H9F3N2O2 | Melting Point | 60-61ºC | |
| MSDS | N/A | Flash Point | 115.5ºC | |
| Name | Ethyl 1-Methyl-3-(Trifluoromethyl)-1H-Pyrazole-4-Carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 267.4ºC at 760mmHg |
| Melting Point | 60-61ºC |
| Molecular Formula | C8H9F3N2O2 |
| Molecular Weight | 222.16400 |
| Flash Point | 115.5ºC |
| Exact Mass | 222.06200 |
| PSA | 44.12000 |
| LogP | 1.61560 |
| Vapour Pressure | 0.00816mmHg at 25°C |
| Index of Refraction | 1.469 |
| InChIKey | ZZEXDJGNURSJOF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cn(C)nc1C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933199090 |
|
~71%
ethyl1-methyl-3... CAS#:111493-74-4 |
| Literature: EP2263999 A1, ; Page/Page column 21 ; |
|
~93%
ethyl1-methyl-3... CAS#:111493-74-4 |
| Literature: WO2006/90778 A1, ; Page/Page column 13 ; |
|
~%
ethyl1-methyl-3... CAS#:111493-74-4 |
| Literature: Molecules, , vol. 17, # 12 p. 14205 - 14218 |
|
~82%
ethyl1-methyl-3... CAS#:111493-74-4 |
| Literature: WO2008/141020 A1, ; Page/Page column 50 ; WO 2008/141020 A1 |
|
~17%
ethyl1-methyl-3... CAS#:111493-74-4 |
| Literature: WO2006/24820 A1, ; Page/Page column 124 ; |
|
~0%
ethyl1-methyl-3... CAS#:111493-74-4 |
| Literature: WO2008/59370 A2, ; Page/Page column 52 ; WO 2008/059370 A2 |
|
~87%
ethyl1-methyl-3... CAS#:111493-74-4 |
| Literature: WO2006/45504 A1, ; Page/Page column 5 ; |
|
~%
ethyl1-methyl-3... CAS#:111493-74-4 |
| Literature: Molecules, , vol. 17, # 12 p. 14205 - 14218 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylate |
| ethyl 1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylate |
| MFCD00277430 |