2,2-Dimethyl-6-nitro-2,3-dihydro-4H-chromen-4-one structure
|
Common Name | 2,2-Dimethyl-6-nitro-2,3-dihydro-4H-chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 111478-49-0 | Molecular Weight | 221.209 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 365.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.1±29.9 °C | |
| Name | 2,2-dimethyl-6-nitro-3H-chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 365.9±42.0 °C at 760 mmHg |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.209 |
| Flash Point | 171.1±29.9 °C |
| Exact Mass | 221.068802 |
| PSA | 72.12000 |
| LogP | 3.02 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | SKWGQIKSBYQUAP-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)c2cc([N+](=O)[O-])ccc2O1 |
| HS Code | 2932999099 |
|---|
|
~%
2,2-Dimethyl-6-... CAS#:111478-49-0 |
| Literature: PFIZER INC. Patent: EP230379 B1, 1991 ; |
|
~90%
2,2-Dimethyl-6-... CAS#:111478-49-0 |
| Literature: Tripathi; Koul; Taneja Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2009 , vol. 48, # 2 p. 301 - 304 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4H-1-Benzopyran-4-one, 2,3-dihydro-2,2-dimethyl-6-nitro- |
| 2,2-DIMETHYL-4'-FLUOROBUTYROPHENONE |
| 2,2-Dimethyl-6-nitro-2,3-dihydro-4H-chromen-4-one |
| 6-Nitro-2,2-dimethylchroman-4-one |
| 4H-1-Benzopyran-4-one,2,3-dihydro-2,2-dimethyl-6-nitro |
| 2,2-dimethyl-6-nitrochroman-4-one |
| 6-nitro-2,2-dimethyl-4-chromanone |