N1-(7-Nitro-2,1,3-benzoxadiazol-4-yl)-N1,N2,N2-tris(2-pyridinylmethyl)-1,2-ethanediamine structure
|
Common Name | N1-(7-Nitro-2,1,3-benzoxadiazol-4-yl)-N1,N2,N2-tris(2-pyridinylmethyl)-1,2-ethanediamine | ||
|---|---|---|---|---|
| CAS Number | 1111625-98-9 | Molecular Weight | 496.52100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H24N8O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | N1-(7-Nitro-2,1,3-benzoxadiazol-4-yl)-N1,N2,N2-tris(2-pyridinylmethyl)-1,2-ethanediamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H24N8O3 |
|---|---|
| Molecular Weight | 496.52100 |
| Exact Mass | 496.19700 |
| PSA | 129.89000 |
| LogP | 4.54820 |
| InChIKey | WBROPDACWHVGSC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N(CCN(Cc2ccccn2)Cc2ccccn2)Cc2ccccn2)c2nonc12 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
| RIDADR | UN 2811 6.1 / PGIII |
|
~62%
N1-(7-Nitro-2,1... CAS#:1111625-98-9 |
| Literature: Qian, Fang; Zhang, Changli; Zhang, Yumin; He, Weijiang; Guo, Zijian; Gao, Xiang; Hu, Ping Journal of the American Chemical Society, 2009 , vol. 131, # 4 p. 1460 - 1468 |
|
~91%
N1-(7-Nitro-2,1... CAS#:1111625-98-9 |
| Literature: Xu, Zhaochao; Kim, Gun-Hee; Han, Su Jung; Jou, Min Jung; Lee, Chongmok; Shin, Injae; Yoon, Juyoung Tetrahedron, 2009 , vol. 65, # 11 p. 2307 - 2312 |
| N'-(4-nitro-2,1,3-benzoxadiazol-7-yl)-N,N,N'-tris(pyridin-2-ylmethyl)ethane-1,2-diamine |