(S)-(+)-2-(N,N-DIBENZYLAMINO)-4-METHYLPENTANOL, 90 structure
|
Common Name | (S)-(+)-2-(N,N-DIBENZYLAMINO)-4-METHYLPENTANOL, 90 | ||
|---|---|---|---|---|
| CAS Number | 111060-53-8 | Molecular Weight | 297.43400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H27NO | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2S)-2-(dibenzylamino)-4-methylpentan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H27NO |
|---|---|
| Molecular Weight | 297.43400 |
| Exact Mass | 297.20900 |
| PSA | 23.47000 |
| LogP | 4.09580 |
| Index of Refraction | n20/D 1.543 |
| InChIKey | FWNZCCUWXPYXDR-FQEVSTJZSA-N |
| SMILES | CC(C)CC(CO)N(Cc1ccccc1)Cc1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| N,N-dibenzyl-(S)-2-amino-4-methyl-1-pentanol |
| O032 |
| (S)-2-(DIBENZYLAMINO)-4-METHYL-1-PENTANOL |
| (S)-2-(dibenzylamino)-4-methylpentan-1-ol |
| 1-Pentanol,2-[bis(phenylmethyl)amino]-4-methyl-,(S) |
| 1-Pentanol,2-[bis(phenylmethyl)amino]-4-methyl-,(2S) |
| (S)-2-(N,N-dibenzylamino)-4-methylpentan-1-ol |
| (S)-2-(N,N-dibenzylamino)-4-methyl-1-pentanol |
| N,N-Dibenzyl-L-Leucinol |
| (S)-2-(N,N-dibenzylamino)-4-methylpentanol |