tert-butyl N-(2-ethylphenyl)carbamate structure
|
Common Name | tert-butyl N-(2-ethylphenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 110969-45-4 | Molecular Weight | 221.29500 | |
| Density | 1.047g/cm3 | Boiling Point | 80-90ºC0.5 mm Hg(lit.) | |
| Molecular Formula | C13H19NO2 | Melting Point | 53-58ºC(lit.) | |
| MSDS | N/A | Flash Point | 117.8ºC | |
| Name | tert-butyl N-(2-ethylphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.047g/cm3 |
|---|---|
| Boiling Point | 80-90ºC0.5 mm Hg(lit.) |
| Melting Point | 53-58ºC(lit.) |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.29500 |
| Flash Point | 117.8ºC |
| Exact Mass | 221.14200 |
| PSA | 41.82000 |
| LogP | 3.60960 |
| Vapour Pressure | 0.00653mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | APURGTAWCSZZBB-UHFFFAOYSA-N |
| SMILES | CCc1ccccc1NC(=O)OC(C)(C)C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| HS Code | 2924299090 |
|
~%
tert-butyl N-(2... CAS#:110969-45-4 |
| Literature: Grehn, Leif; Gunnarsson, Kerstin; Ragnarsson, Ulf Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1987 , vol. 41, # 1 p. 18 - 23 |
|
~%
tert-butyl N-(2... CAS#:110969-45-4 |
| Literature: Clark; Muchowski; Fisher; Flippin; Repke; Souchet Synthesis, 1991 , # 10 p. 871 - 878 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD03427028 |
| t-Boc-2-Ethylaniline |
| N-(tert-Butoxycarbonyl)-2-ethylaniline |
| 2-ethyl-N-(tert-butoxycarbonyl)aniline |
| N-Boc-2-ethylaniline |