4-(2,4-Difluorophenyl)-4-oxobutanoic acid structure
|
Common Name | 4-(2,4-Difluorophenyl)-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 110931-77-6 | Molecular Weight | 214.165 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 366.7±32.0 °C at 760 mmHg | |
| Molecular Formula | C10H8F2O3 | Melting Point | 115.0-119.0°C | |
| MSDS | N/A | Flash Point | 175.6±25.1 °C | |
| Name | 4-(2,4-Difluorophenyl)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 366.7±32.0 °C at 760 mmHg |
| Melting Point | 115.0-119.0°C |
| Molecular Formula | C10H8F2O3 |
| Molecular Weight | 214.165 |
| Flash Point | 175.6±25.1 °C |
| Exact Mass | 214.044144 |
| PSA | 54.37000 |
| LogP | 1.01 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | OKYUHFSCTFNDFB-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)c1ccc(F)cc1F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| HS Code | 2918300090 |
|
~%
4-(2,4-Difluoro... CAS#:110931-77-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 36, # 19 p. 2810 - 2816 |
|
~%
4-(2,4-Difluoro... CAS#:110931-77-6 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 22 p. 5537 - 5542 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzenebutanoic acid, 2,4-difluoro-γ-oxo- |
| 3-(2,4-Difluorobenzoyl)propionic Acid |
| 4-(2,4-Difluorophenyl)-4-oxobutanoic acid |
| 4-(2,4-Difluorophenyl)-4-oxobutyric Acid |
| MFCD00143016 |