N-retinoylglycine
Modify Date: 2025-08-25 14:26:34
N-retinoylglycine structure
|
Common Name | N-retinoylglycine | ||
|---|---|---|---|---|
| CAS Number | 110848-62-9 | Molecular Weight | 357.48600 | |
| Density | 1.063g/cm3 | Boiling Point | 580.6ºC at 760mmHg | |
| Molecular Formula | C22H31NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305ºC | |
| Name | 2-[[(2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoyl]amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.063g/cm3 |
|---|---|
| Boiling Point | 580.6ºC at 760mmHg |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.48600 |
| Flash Point | 305ºC |
| Exact Mass | 357.23000 |
| PSA | 69.89000 |
| LogP | 5.55910 |
| Vapour Pressure | 5.44E-15mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | ZETCVMXUHPTVOW-XQSIOCNLSA-N |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)NCC(=O)O |
|
~77%
N-retinoylglycine CAS#:110848-62-9 |
| Literature: Shealy; Frye; Schiff Journal of Medicinal Chemistry, 1988 , vol. 31, # 1 p. 190 - 196 |
|
~%
N-retinoylglycine CAS#:110848-62-9 |
| Literature: Shealy; Frye; Schiff Journal of Medicinal Chemistry, 1988 , vol. 31, # 1 p. 190 - 196 |
|
~%
N-retinoylglycine CAS#:110848-62-9 |
| Literature: Shealy; Frye; Schiff Journal of Medicinal Chemistry, 1988 , vol. 31, # 1 p. 190 - 196 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-(13-cis-retinoyl)glycine |
| Glycine,N-(3,7-dimethyl-1-oxo-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraenyl)-,(Z,E,E,E) |