1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carbaldehyde
Modify Date: 2025-08-27 13:03:32
1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carbaldehyde structure
|
Common Name | 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 110719-57-8 | Molecular Weight | 315.34200 | |
| Density | 1.426g/cm3 | Boiling Point | 556.5ºC at 760mmHg | |
| Molecular Formula | C17H18FN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.4ºC | |
| Name | 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.426g/cm3 |
|---|---|
| Boiling Point | 556.5ºC at 760mmHg |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.34200 |
| Flash Point | 290.4ºC |
| Exact Mass | 315.13800 |
| PSA | 54.34000 |
| LogP | 2.09140 |
| Vapour Pressure | 2.02E-12mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | VONPFCWZOZLFSZ-UHFFFAOYSA-N |
| SMILES | O=Cc1cn(C2CC2)c2cc(N3CCNCC3)c(F)cc2c1=O |
|
~63%
1-cyclopropyl-6... CAS#:110719-57-8 |
| Literature: Kondo; Sakamoto; Kawakami; Tsukamoto Journal of Medicinal Chemistry, 1988 , vol. 31, # 1 p. 221 - 225 |
|
~%
1-cyclopropyl-6... CAS#:110719-57-8 |
| Literature: Kondo; Sakamoto; Kawakami; Tsukamoto Journal of Medicinal Chemistry, 1988 , vol. 31, # 1 p. 221 - 225 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Cffopq |
| 1-cyclopropyl-6-fluoro-3-formyl-1,4-dihydro-4-oxo-7-piperazinylquinoline |
| 3-Quinolinecarboxaldehyde,1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl) |