CI-966
Modify Date: 2025-08-24 09:00:15
CI-966 structure
|
Common Name | CI-966 | ||
|---|---|---|---|---|
| CAS Number | 110283-79-9 | Molecular Weight | 473.40800 | |
| Density | 1.34g/cm3 | Boiling Point | 514.1ºC at 760mmHg | |
| Molecular Formula | C23H21F6NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.7ºC | |
Use of CI-966CI-966 (PD 126141) is a potent, selective inhibitor of the GABA transporter GAT-1 with IC50 of 0.26 and 1.2 uM for human and rat GAT-1, respectively. |
| Name | 1-[2-[bis[4-(trifluoromethyl)phenyl]methoxy]ethyl]-3,6-dihydro-2H-pyridine-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 514.1ºC at 760mmHg |
| Molecular Formula | C23H21F6NO3 |
| Molecular Weight | 473.40800 |
| Flash Point | 264.7ºC |
| Exact Mass | 473.14300 |
| PSA | 49.77000 |
| LogP | 5.48480 |
| Vapour Pressure | 2.16E-11mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | CMHQDSBIBSKHFP-UHFFFAOYSA-N |
| SMILES | O=C(O)C1=CCCN(CCOC(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)C1 |
![1,2,5,6-tetrahydro-1-[2-[bis[4-(trifluoromethyl)phenyl]methoxy]ethyl]-3-pyridinecarboxylic acid methyl ester structure](https://image.chemsrc.com/caspic/376/132284-15-2.png)
| 1-[2-[bis[4-(trifluoromethyl)phenyl]methoxy]ethyl]-1,2,5,6-tetrahydro-3-pyridine carboxylic acid |
| 1-(2-(Bis(4-(trifluoromethyl)phenyl)methoxy)ethyl)-1,2,5,6-tetrahydropyridine-3-carboxylic acid |
| CI-966 |
| 1,2,5,6-tetrahydro-1-<2-<bis<4-(trifluoromethyl)phenyl>methoxy>ethyl>-3-pyridinecarboxylic acid |
| 3-Pyridinecarboxylicacid,1-[2-[bis[4-(trifluoromethyl)phenyl]methoxy]ethyl]-1,2,5,6-tetrahydro |
| Tocris-1296 |