12-Epinapelline structure
|
Common Name | 12-Epinapelline | ||
|---|---|---|---|---|
| CAS Number | 110064-71-6 | Molecular Weight | 359.502 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 537.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H33NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.2±28.8 °C | |
Use of 12-Epinapelline12-Epinapelline is a diterpene alkaloid isolated from Aconitum baikalense. 12-Epinapelline exhibits Anti-inflammatory activity and stimulates the growth of colonies from fibroblast precursors[1][2]. |
| Name | 12-epi-napelline |
|---|---|
| Synonym | More Synonyms |
| Description | 12-Epinapelline is a diterpene alkaloid isolated from Aconitum baikalense. 12-Epinapelline exhibits Anti-inflammatory activity and stimulates the growth of colonies from fibroblast precursors[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 537.8±50.0 °C at 760 mmHg |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.502 |
| Flash Point | 284.2±28.8 °C |
| Exact Mass | 359.246033 |
| PSA | 63.93000 |
| LogP | 0.78 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | AZAZKLKDEOMJBJ-CZUKDYLVSA-N |
| SMILES | C=C1C2CC3(C1O)C1CC4C5(C)CCC(O)C4(C1N(CC)C5)C3CC2O |
| (1R,2R,4R,5R,7R,8R,10R,13R,17R)-11-Ethyl-13-methyl-6-methylene-11-azahexacyclo[7.7.2.1.0.0.0]nonadecane-4,7,16-triol |
| 12-epinapelline |
| Epinapelline, 12- |