Acoforestinine structure
|
Common Name | Acoforestinine | ||
|---|---|---|---|---|
| CAS Number | 110011-77-3 | Molecular Weight | 645.780 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 712.0±60.0 °C at 760 mmHg | |
| Molecular Formula | C35H51NO10 | Melting Point | 99-101℃ | |
| MSDS | N/A | Flash Point | 384.4±32.9 °C | |
Use of AcoforestinineAcoforestinine is a diterpenoid alkaloid isolated from Aconitum handelianum[1]. |
| Name | 8-ethoxylyunnaconitine |
|---|---|
| Synonym | More Synonyms |
| Description | Acoforestinine is a diterpenoid alkaloid isolated from Aconitum handelianum[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 712.0±60.0 °C at 760 mmHg |
| Melting Point | 99-101℃ |
| Molecular Formula | C35H51NO10 |
| Molecular Weight | 645.780 |
| Flash Point | 384.4±32.9 °C |
| Exact Mass | 645.351318 |
| PSA | 125.38000 |
| LogP | 1.78 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | YBCOIJNAMJAFSO-VNGQWLLOSA-N |
| SMILES | CCOC12CC(OC)C3(O)CC(C1C3OC(=O)c1ccc(OC)cc1)C13C(OC)CC(O)C4(COC)CN(CC)C1C2C(OC)C43 |
| Acoforestinine |
| (1α,3α,6α,14α,16β)-8-Ethoxy-20-ethyl-3,13-dihydroxy-1,6,16-trimethoxy-4-(methoxymethyl)aconitan-14-yl 4-methoxybenzoate |
| 8-deacetylyunaconitine |
| 8-O-ethylyunaconitine |
| Benzoic acid, 4-methoxy-, (1α,3α,6α,14α,16β)-8-ethoxy-20-ethyl-3,13-dihydroxy-1,6,16-trimethoxy-4-(methoxymethyl)aconitan-14-yl ester |