Dansylleucine structure
|
Common Name | Dansylleucine | ||
|---|---|---|---|---|
| CAS Number | 1100-22-7 | Molecular Weight | 364.45900 | |
| Density | 1.256g/cm3 | Boiling Point | 545ºC at 760mmHg | |
| Molecular Formula | C18H24N2O4S | Melting Point | 126ºC | |
| MSDS | N/A | Flash Point | 283.4ºC | |
Use of DansylleucineDansyl-L-leucine is a leucine derivative[1]. |
| Name | dansyl-l-leucine |
|---|---|
| Synonym | More Synonyms |
| Description | Dansyl-L-leucine is a leucine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.256g/cm3 |
|---|---|
| Boiling Point | 545ºC at 760mmHg |
| Melting Point | 126ºC |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.45900 |
| Flash Point | 283.4ºC |
| Exact Mass | 364.14600 |
| PSA | 95.09000 |
| LogP | 4.15510 |
| Vapour Pressure | 1.03E-12mmHg at 25°C |
| Index of Refraction | -9.5 ° (C=1, EtOH) |
| InChIKey | XBMQRPDOXIPUFG-HNNXBMFYSA-N |
| SMILES | CC(C)CC(NS(=O)(=O)c1cccc2c(N(C)C)cccc12)C(=O)O |
| HS Code | 2935009090 |
|---|
|
~%
Dansylleucine CAS#:1100-22-7 |
| Literature: Analytical Chemistry, , vol. 68, # 7 p. 1191 - 1196 Pharmazie, , vol. 53, # 12 p. 863 - 865 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Dansyl-L-leucine |
| 5-Dimethylaminonaphthalene-1-sulfonyl-L-leucineDns-Leu-OH |
| 5-Dimethylaminonaphthalene-1-sulfonyl-L-leucine |
| Dns-Leu-OH |
| N-dansyl-L-leucine |
| 5-DIMETHYLAMINONAPHTHALENE-1-SULFONYL-L-LEUCINE |
| Dansylleucine |
| N-Dns-L-Leucine |