N-Isopropyl-5-methoxytryptamine
Modify Date: 2025-08-25 18:05:39
N-Isopropyl-5-methoxytryptamine structure
|
Common Name | N-Isopropyl-5-methoxytryptamine | ||
|---|---|---|---|---|
| CAS Number | 109921-55-3 | Molecular Weight | 232.32100 | |
| Density | 1.09g/cm3 | Boiling Point | 379.7ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.4ºC | |
| Name | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]propan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 379.7ºC at 760 mmHg |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.32100 |
| Flash Point | 183.4ºC |
| Exact Mass | 232.15800 |
| PSA | 37.05000 |
| LogP | 3.10790 |
| Vapour Pressure | 5.74E-06mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | QQZJNZJNPDORBO-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]cc(CCNC(C)C)c2c1 |
| HS Code | 2933990090 |
|---|
|
~75%
N-Isopropyl-5-m... CAS#:109921-55-3 |
| Literature: Biochemical Pharmacology, , vol. 71, # 9 p. 1377 - 1385 |
|
~%
N-Isopropyl-5-m... CAS#:109921-55-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 16 p. 4657 - 4663 |
|
~%
N-Isopropyl-5-m... CAS#:109921-55-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 16 p. 4657 - 4663 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| isopropyl-[2-(5-methoxy-indol-3-yl)-ethyl]-amine |
| Isopropyl-<2-(5-methoxy-indol-3-yl)-ethyl>-amin |
| 5-MeO-NIPT |
| 1H-Indole-3-ethanamine,5-methoxy-N-(1-methylethyl) |
| N-Isopropyl-5-methoxytryptamine |
| 5-Methoxy-N-isopropyl Tryptamine |