CL-423530 structure
|
Common Name | CL-423530 | ||
|---|---|---|---|---|
| CAS Number | 1095530-73-6 | Molecular Weight | 302.76 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H15ClN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CL-423530SERT inhibitor SERT inhibitor |
| Name | CL-423530 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.76 |
| Exact Mass | 351.071136 |
| LogP | 2.55 |
| Index of Refraction | 1.653 |
| InChIKey | BUBDWBMVMWMBJV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC2C(=O)Nc2nccs2)cc1 |
| 2-Pyrrolidinecarboxamide, 1-[(4-methylphenyl)sulfonyl]-N-2-thiazolyl- |
| 1-[(4-Methylphenyl)sulfonyl]-N-1,3-thiazol-2-ylprolinamide |